C28H34O2SSeSi — CID 11599140
dimethyl-[(1S,2S,3S)-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)cyclopentyl]-phenylsilane (PubChem CID 11599140) has the molecular formula C28H34O2SSeSi and a molecular weight of 541.69 g/mol. Its IUPAC name is dimethyl-[(1S,2S,3S)-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)cyclopentyl]-phenylsilane.
| Compound Name | dimethyl-[(1S,2S,3S)-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)cyclopentyl]-phenylsilane |
|---|---|
| PubChem CID | 11599140 |
| Molecular Formula | C28H34O2SSeSi |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | dimethyl-[(1S,2S,3S)-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)cyclopentyl]-phenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H]2[C@@H](C[Se]c3ccccc3)CC[C@@H]2[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34O2SSeSi/c1-22-14-17-24(18-15-22)31(29,30)20-27-23(21-32-25-10-6-4-7-11-25)16-19-28(27)33(2,3)26-12-8-5-9-13-26/h4-15,17-18,23,27-28H,16,19-21H2,1-3H3/t23-,27+,28+/m1/s1 |
| InChIKey | GIAUFGZLMKQWAT-UIUQJESISA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|