C12H21N9 — CID 115991955
2-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 115991955) has the molecular formula C12H21N9 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 115991955 |
| Molecular Formula | C12H21N9 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1nn(C)cc1CNc1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H21N9/c1-5-9-8(7-21(4)19-9)6-14-10-15-11(18-13)17-12(16-10)20(2)3/h7H,5-6,13H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | ZDKOKIUUYULHHB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|