C23H15F6N7OS — CID 11599252
N-(4-carbamimidoylphenyl)-4-(trifluoromethyl)-2-[[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]pyrimidine-5-carboxamide (PubChem CID 11599252) has the molecular formula C23H15F6N7OS and a molecular weight of 551.48 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-4-(trifluoromethyl)-2-[[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-(4-carbamimidoylphenyl)-4-(trifluoromethyl)-2-[[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11599252 |
| Molecular Formula | C23H15F6N7OS |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-4-(trifluoromethyl)-2-[[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]pyrimidine-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cnc(Nc3nc(-c4cccc(C(F)(F)F)c4)cs3)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H15F6N7OS/c24-22(25,26)13-3-1-2-12(8-13)16-10-38-21(34-16)36-20-32-9-15(17(35-20)23(27,28)29)19(37)33-14-6-4-11(5-7-14)18(30)31/h1-10H,(H3,30,31)(H,33,37)(H,32,34,35,36) |
| InChIKey | MNYQKGQBOWDKKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|