C13H13F2N3O2S — CID 115992748
2-amino-3-[(2,5-difluorophenyl)methylamino]benzenesulfonamide (PubChem CID 115992748) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-amino-3-[(2,5-difluorophenyl)methylamino]benzenesulfonamide.
| Compound Name | 2-amino-3-[(2,5-difluorophenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 115992748 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-amino-3-[(2,5-difluorophenyl)methylamino]benzenesulfonamide |
| SMILES | Nc1c(NCc2cc(F)ccc2F)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H13F2N3O2S/c14-9-4-5-10(15)8(6-9)7-18-11-2-1-3-12(13(11)16)21(17,19)20/h1-6,18H,7,16H2,(H2,17,19,20) |
| InChIKey | VGILRRXPFBPPEL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|