C12H14N4O4S — CID 115992951
ethyl 1-(2-amino-3-sulfamoylphenyl)pyrazole-4-carboxylate (PubChem CID 115992951) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is ethyl 1-(2-amino-3-sulfamoylphenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-amino-3-sulfamoylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 115992951 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl 1-(2-amino-3-sulfamoylphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(S(N)(=O)=O)c2N)c1 |
| InChI | InChI=1S/C12H14N4O4S/c1-2-20-12(17)8-6-15-16(7-8)9-4-3-5-10(11(9)13)21(14,18)19/h3-7H,2,13H2,1H3,(H2,14,18,19) |
| InChIKey | ZOIREHXUDNSYCM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|