C12H17N3O4S — CID 115993381
3-amino-N-(cyclopentylmethyl)-2-nitrobenzenesulfonamide (PubChem CID 115993381) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-amino-N-(cyclopentylmethyl)-2-nitrobenzenesulfonamide.
| Compound Name | 3-amino-N-(cyclopentylmethyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115993381 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-amino-N-(cyclopentylmethyl)-2-nitrobenzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)NCC2CCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4S/c13-10-6-3-7-11(12(10)15(16)17)20(18,19)14-8-9-4-1-2-5-9/h3,6-7,9,14H,1-2,4-5,8,13H2 |
| InChIKey | ZSRUOGFIVHLAFV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|