C38H54Si2 — CID 11599431
2-[5-(3,5-ditert-butylphenyl)-2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 11599431) has the molecular formula C38H54Si2 and a molecular weight of 567.02 g/mol. Its IUPAC name is 2-[5-(3,5-ditert-butylphenyl)-2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[5-(3,5-ditert-butylphenyl)-2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11599431 |
| Molecular Formula | C38H54Si2 |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 2-[5-(3,5-ditert-butylphenyl)-2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)ccc1C#CC#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H54Si2/c1-28(2)40(29(3)4,30(5)6)23-21-33-24-32(20-19-31(33)18-16-17-22-39(13,14)15)34-25-35(37(7,8)9)27-36(26-34)38(10,11)12/h19-20,24-30H,1-15H3 |
| InChIKey | BIQXMSKNGOHLLQ-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|