C36H30N6O2 — CID 11599533
2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione (PubChem CID 11599533) has the molecular formula C36H30N6O2 and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11599533 |
| Molecular Formula | C36H30N6O2 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-[[4-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]isoindole-1,3-dione |
| SMILES | Nc1nccn2c(C3CCC(CN4C(=O)c5ccccc5C4=O)CC3)nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C36H30N6O2/c37-33-32-31(26-15-14-24-16-17-29(39-30(24)20-26)23-6-2-1-3-7-23)40-34(41(32)19-18-38-33)25-12-10-22(11-13-25)21-42-35(43)27-8-4-5-9-28(27)36(42)44/h1-9,14-20,22,25H,10-13,21H2,(H2,37,38) |
| InChIKey | SWCIISDMFBNTHC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|