C15H25FN2O2 — CID 115996898
1-[[3-amino-3-(2-fluorophenyl)-2-methylpropyl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 115996898) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-[[3-amino-3-(2-fluorophenyl)-2-methylpropyl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[3-amino-3-(2-fluorophenyl)-2-methylpropyl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 115996898 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-[[3-amino-3-(2-fluorophenyl)-2-methylpropyl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)CC(C)C(N)c1ccccc1F |
| InChI | InChI=1S/C15H25FN2O2/c1-11(8-18(2)9-12(19)10-20-3)15(17)13-6-4-5-7-14(13)16/h4-7,11-12,15,19H,8-10,17H2,1-3H3 |
| InChIKey | PCCVEWRJTQPUBO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |