C16H23FO3 — CID 115997209
ethyl 3-(2-fluorophenyl)-3-hydroxy-2-propylpentanoate (PubChem CID 115997209) has the molecular formula C16H23FO3 and a molecular weight of 282.36 g/mol. Its IUPAC name is ethyl 3-(2-fluorophenyl)-3-hydroxy-2-propylpentanoate.
| Compound Name | ethyl 3-(2-fluorophenyl)-3-hydroxy-2-propylpentanoate |
|---|---|
| PubChem CID | 115997209 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl 3-(2-fluorophenyl)-3-hydroxy-2-propylpentanoate |
| SMILES | CCCC(C(=O)OCC)C(O)(CC)c1ccccc1F |
| InChI | InChI=1S/C16H23FO3/c1-4-9-13(15(18)20-6-3)16(19,5-2)12-10-7-8-11-14(12)17/h7-8,10-11,13,19H,4-6,9H2,1-3H3 |
| InChIKey | RXKLZKDUGCZKBV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |