C28H44N2O9S — CID 11599787
[1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11599787) has the molecular formula C28H44N2O9S and a molecular weight of 584.73 g/mol. Its IUPAC name is [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11599787 |
| Molecular Formula | C28H44N2O9S |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CCCCCCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(CN1CCOCC1)OC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H44N2O9S/c1-5-6-7-8-9-16-35-24-23(37-26-25(24)38-28(3,4)39-26)22(19-30-14-17-34-18-15-30)36-27(31)29-40(32,33)21-12-10-20(2)11-13-21/h10-13,22-26H,5-9,14-19H2,1-4H3,(H,29,31)/t22?,23-,24+,25-,26-/m1/s1 |
| InChIKey | BKBDJPOJWRHLBC-NZFACQQJSA-N |
| XLogP | 3.34 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|