C37H42N4O5 — CID 11599797
methyl (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoate (PubChem CID 11599797) has the molecular formula C37H42N4O5 and a molecular weight of 622.77 g/mol. Its IUPAC name is methyl (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoate.
| Compound Name | methyl (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoate |
|---|---|
| PubChem CID | 11599797 |
| Molecular Formula | C37H42N4O5 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | methyl (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxo-8-[2-(2-phenyl-1H-indol-3-yl)ethylamino]octanoate |
| SMILES | COC(=O)CCCCC[C@H](NC(=O)Cc1c(C)[nH]c2ccc(OC)cc12)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C37H42N4O5/c1-24-29(30-22-26(45-2)18-19-32(30)39-24)23-34(42)40-33(16-8-5-9-17-35(43)46-3)37(44)38-21-20-28-27-14-10-11-15-31(27)41-36(28)25-12-6-4-7-13-25/h4,6-7,10-15,18-19,22,33,39,41H,5,8-9,16-17,20-21,23H2,1-3H3,(H,38,44)(H,40,42)/t33-/m0/s1 |
| InChIKey | WBURJDQDBKPXRR-XIFFEERXSA-N |
| XLogP | 6.14 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|