C18H29NO — CID 115998847
3-ethoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 115998847) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 3-ethoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 3-ethoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 115998847 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 3-ethoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | CCOc1cccc(NC2CC(C)(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H29NO/c1-6-20-16-9-7-8-14(10-16)19-15-11-17(2,3)13-18(4,5)12-15/h7-10,15,19H,6,11-13H2,1-5H3 |
| InChIKey | QHOQFVZAFSJYKK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |