C18H29NO — CID 115998881
4-methoxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 115998881) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 4-methoxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 115998881 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 4-methoxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | COc1ccc(NC2CC(C)(C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/C18H29NO/c1-13-9-14(7-8-16(13)20-6)19-15-10-17(2,3)12-18(4,5)11-15/h7-9,15,19H,10-12H2,1-6H3 |
| InChIKey | UPBXRYJIUKEVIX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|