C19H31NO — CID 115998927
3-phenyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]propan-1-ol (PubChem CID 115998927) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 3-phenyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]propan-1-ol.
| Compound Name | 3-phenyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 115998927 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 3-phenyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]propan-1-ol |
| SMILES | CC1(C)CC(NC(CO)Cc2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H31NO/c1-18(2)11-17(12-19(3,4)14-18)20-16(13-21)10-15-8-6-5-7-9-15/h5-9,16-17,20-21H,10-14H2,1-4H3 |
| InChIKey | FUUHZAKHGWVZOJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |