C16H24N2OS — CID 115998998
2-amino-N-cyclopropyl-5,5,7,7-tetramethyl-4,6-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 115998998) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-5,5,7,7-tetramethyl-4,6-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-amino-N-cyclopropyl-5,5,7,7-tetramethyl-4,6-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 115998998 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-amino-N-cyclopropyl-5,5,7,7-tetramethyl-4,6-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(N)c2C(=O)NC2CC2)C(C)(C)C1 |
| InChI | InChI=1S/C16H24N2OS/c1-15(2)7-10-11(14(19)18-9-5-6-9)13(17)20-12(10)16(3,4)8-15/h9H,5-8,17H2,1-4H3,(H,18,19) |
| InChIKey | STDRQPZOFMLRNB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|