C16H21NO2 — CID 115999982
N-butan-2-yl-3-(3-hydroxyprop-1-ynyl)-N,5-dimethylbenzamide (PubChem CID 115999982) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-butan-2-yl-3-(3-hydroxyprop-1-ynyl)-N,5-dimethylbenzamide.
| Compound Name | N-butan-2-yl-3-(3-hydroxyprop-1-ynyl)-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 115999982 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-butan-2-yl-3-(3-hydroxyprop-1-ynyl)-N,5-dimethylbenzamide |
| SMILES | CCC(C)N(C)C(=O)c1cc(C)cc(C#CCO)c1 |
| InChI | InChI=1S/C16H21NO2/c1-5-13(3)17(4)16(19)15-10-12(2)9-14(11-15)7-6-8-18/h9-11,13,18H,5,8H2,1-4H3 |
| InChIKey | BFCXEQYAGZVINP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|