C25H17BrCl2F2N3O6PS — CID 11600112
2-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]anilino]-2-oxoacetic acid (PubChem CID 11600112) has the molecular formula C25H17BrCl2F2N3O6PS and a molecular weight of 707.27 g/mol. Its IUPAC name is 2-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]anilino]-2-oxoacetic acid.
| Compound Name | 2-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 11600112 |
| Molecular Formula | C25H17BrCl2F2N3O6PS |
| Molecular Weight | 707.27 g/mol |
| Exact Mass | 704.91 |
| IUPAC Name | 2-[4-[2-[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]-3,4-dichloroanilino]-1,3-thiazol-4-yl]anilino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1ccc(-c2csc(N(Cc3ccc(C(F)(F)P(=O)(O)O)c(Br)c3)c3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C25H17BrCl2F2N3O6PS/c26-18-9-13(1-7-17(18)25(29,30)40(37,38)39)11-33(16-6-8-19(27)20(28)10-16)24-32-21(12-41-24)14-2-4-15(5-3-14)31-22(34)23(35)36/h1-10,12H,11H2,(H,31,34)(H,35,36)(H2,37,38,39) |
| InChIKey | RCFBFKXKEWZIFD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.27 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|