About (3S)-3-hydroxy-N,N-dimethylbutanamide
(3S)-3-hydroxy-N,N-dimethylbutanamide (PubChem CID 11600674) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is (3S)-3-hydroxy-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-N,N-dimethylbutanamide |
| PubChem CID | 11600674 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S)-3-hydroxy-N,N-dimethylbutanamide |
| SMILES | C[C@H](O)CC(=O)N(C)C |
| InChI | InChI=1S/C6H13NO2/c1-5(8)4-6(9)7(2)3/h5,8H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | OHICCAZEETWRET-YFKPBYRVSA-N |
| XLogP | -0.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-hydroxy-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-N,N-dimethylbutanamide?
The IUPAC name of (3S)-3-hydroxy-N,N-dimethylbutanamide (CID 11600674) is (3S)-3-hydroxy-N,N-dimethylbutanamide.
What is the SMILES notation for (3S)-3-hydroxy-N,N-dimethylbutanamide?
The canonical SMILES for (3S)-3-hydroxy-N,N-dimethylbutanamide is C[C@H](O)CC(=O)N(C)C.
What is the InChIKey of (3S)-3-hydroxy-N,N-dimethylbutanamide?
The InChIKey is OHICCAZEETWRET-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5(8)4-6(9)7(2)3/h5,8H,4H2,1-3H3/t5-/m0/s1.
What are the key properties of (3S)-3-hydroxy-N,N-dimethylbutanamide?
(3S)-3-hydroxy-N,N-dimethylbutanamide has a molecular weight of 131.17 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-N,N-dimethylbutanamide is sourced from PubChem (CID 11600674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).