About 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one
1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one (PubChem CID 11600845) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one |
| PubChem CID | 11600845 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one |
| SMILES | N[C@@H]1CCCC[C@H]1N1CCC=CC1=O |
| InChI | InChI=1S/C11H18N2O/c12-9-5-1-2-6-10(9)13-8-4-3-7-11(13)14/h3,7,9-10H,1-2,4-6,8,12H2/t9-,10-/m1/s1 |
| InChIKey | ZYYACVULIFUXQS-NXEZZACHSA-N |
| XLogP | 1.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one?
The IUPAC name of 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one (CID 11600845) is 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one is N[C@@H]1CCCC[C@H]1N1CCC=CC1=O.
What is the InChIKey of 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one?
The InChIKey is ZYYACVULIFUXQS-NXEZZACHSA-N. The full InChI is InChI=1S/C11H18N2O/c12-9-5-1-2-6-10(9)13-8-4-3-7-11(13)14/h3,7,9-10H,1-2,4-6,8,12H2/t9-,10-/m1/s1.
What are the key properties of 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one?
1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one has a molecular weight of 194.28 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-aminocyclohexyl]-2,3-dihydropyridin-6-one is sourced from PubChem (CID 11600845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).