About 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol
2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol (PubChem CID 11600917) has the molecular formula C12H13ClO
and a molecular weight of 208.69 g/mol. Its IUPAC name is 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol |
| PubChem CID | 11600917 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol |
| SMILES | OCCC1=CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C12H13ClO/c13-12-6-2-4-10-9(7-8-14)3-1-5-11(10)12/h2-4,6,14H,1,5,7-8H2 |
| InChIKey | OJABSVXYVTWBFT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol?
The IUPAC name of 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol (CID 11600917) is 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol.
What is the SMILES notation for 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol?
The canonical SMILES for 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol is OCCC1=CCCc2c(Cl)cccc21.
What is the InChIKey of 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol?
The InChIKey is OJABSVXYVTWBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO/c13-12-6-2-4-10-9(7-8-14)3-1-5-11(10)12/h2-4,6,14H,1,5,7-8H2.
What are the key properties of 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol?
2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol has a molecular weight of 208.69 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-3,4-dihydronaphthalen-1-yl)ethanol is sourced from PubChem (CID 11600917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).