C11H18O4 — CID 11600959
(4R,5S)-5-[(1S)-1-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 11600959) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (4R,5S)-5-[(1S)-1-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-[(1S)-1-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 11600959 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (4R,5S)-5-[(1S)-1-methoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C=CC[C@H](OC)[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C11H18O4/c1-5-6-8(13-4)10-9(7-12)14-11(2,3)15-10/h5,7-10H,1,6H2,2-4H3/t8-,9-,10-/m0/s1 |
| InChIKey | ZFFSHFQTOKXNFY-GUBZILKMSA-N |
| XLogP | 1.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|