About methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate
methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate (PubChem CID 11601107) has the molecular formula C12H11ClN2O
and a molecular weight of 234.69 g/mol. Its IUPAC name is methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate.
Molecular Properties
| Compound Name | methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
| PubChem CID | 11601107 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
| SMILES | CO/C(=N\[C@H]1C[C@@H]1C#N)c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O/c1-16-12(15-11-6-8(11)7-14)9-4-2-3-5-10(9)13/h2-5,8,11H,6H2,1H3/b15-12-/t8-,11+/m1/s1 |
| InChIKey | QCAQTIAUMGCBMJ-FBJIBIMTSA-N |
| XLogP | 2.65 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate?
The IUPAC name of methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate (CID 11601107) is methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate.
What is the SMILES notation for methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate?
The canonical SMILES for methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate is CO/C(=N\[C@H]1C[C@@H]1C#N)c1ccccc1Cl.
What is the InChIKey of methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate?
The InChIKey is QCAQTIAUMGCBMJ-FBJIBIMTSA-N. The full InChI is InChI=1S/C12H11ClN2O/c1-16-12(15-11-6-8(11)7-14)9-4-2-3-5-10(9)13/h2-5,8,11H,6H2,1H3/b15-12-/t8-,11+/m1/s1.
What are the key properties of methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate?
methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate has a molecular weight of 234.69 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate is sourced from PubChem (CID 11601107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).