C12H11ClN2O — CID 11601107
methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate (PubChem CID 11601107) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate.
| Compound Name | methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
|---|---|
| PubChem CID | 11601107 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 2-chloro-N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
| SMILES | CO/C(=N\[C@H]1C[C@@H]1C#N)c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O/c1-16-12(15-11-6-8(11)7-14)9-4-2-3-5-10(9)13/h2-5,8,11H,6H2,1H3/b15-12-/t8-,11+/m1/s1 |
| InChIKey | QCAQTIAUMGCBMJ-FBJIBIMTSA-N |
| XLogP | 2.65 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|