methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate

C8H8Cl2O4 — CID 11601145

IUPACmethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate
SMILESCOC(=O)C(C)C1OC(=O)C(Cl)=C1Cl
InChIInChI=1S/C8H8Cl2O4/c1-3(7(11)13-2)6-4(9)5(10)8(12)14-6/h3,6H,1-2H3
InChIKeyBXQMUVRESWFEDC-UHFFFAOYSA-N
MW239.05 g/mol
LogP1.41
Rot. Bonds2

About methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate

methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate (PubChem CID 11601145) has the molecular formula C8H8Cl2O4 and a molecular weight of 239.05 g/mol. Its IUPAC name is methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate
PubChem CID11601145
Molecular FormulaC8H8Cl2O4
Molecular Weight239.05 g/mol
Exact Mass237.98
IUPAC Namemethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate
SMILESCOC(=O)C(C)C1OC(=O)C(Cl)=C1Cl
InChIInChI=1S/C8H8Cl2O4/c1-3(7(11)13-2)6-4(9)5(10)8(12)14-6/h3,6H,1-2H3
InChIKeyBXQMUVRESWFEDC-UHFFFAOYSA-N
XLogP1.41
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.05
LogP ≤ 51.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate?
The IUPAC name of methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate (CID 11601145) is methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate.
What is the SMILES notation for methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate?
The canonical SMILES for methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate is COC(=O)C(C)C1OC(=O)C(Cl)=C1Cl.
What is the InChIKey of methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate?
The InChIKey is BXQMUVRESWFEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O4/c1-3(7(11)13-2)6-4(9)5(10)8(12)14-6/h3,6H,1-2H3.
What are the key properties of methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate?
methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate has a molecular weight of 239.05 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanoate is sourced from PubChem (CID 11601145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).