About 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene
1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene (PubChem CID 11601177) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene |
| PubChem CID | 11601177 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene |
| SMILES | C=CCOc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C11H13BrO/c1-4-5-13-11-9(3)6-8(2)7-10(11)12/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | ZOXMLHHVXYIYNK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene?
The IUPAC name of 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene (CID 11601177) is 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene.
What is the SMILES notation for 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene?
The canonical SMILES for 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene is C=CCOc1c(C)cc(C)cc1Br.
What is the InChIKey of 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene?
The InChIKey is ZOXMLHHVXYIYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c1-4-5-13-11-9(3)6-8(2)7-10(11)12/h4,6-7H,1,5H2,2-3H3.
What are the key properties of 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene?
1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene has a molecular weight of 241.13 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-dimethyl-2-prop-2-enoxybenzene is sourced from PubChem (CID 11601177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).