C29H30N6O2 — CID 1160123
3-[(R)-[benzyl(ethyl)amino]-(1-benzyltetrazol-5-yl)methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 1160123) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-[(R)-[benzyl(ethyl)amino]-(1-benzyltetrazol-5-yl)methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(R)-[benzyl(ethyl)amino]-(1-benzyltetrazol-5-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1160123 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[(R)-[benzyl(ethyl)amino]-(1-benzyltetrazol-5-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c([C@H](c3nnnn3Cc3ccccc3)N(CC)Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C29H30N6O2/c1-3-34(19-21-11-7-5-8-12-21)27(28-31-32-33-35(28)20-22-13-9-6-10-14-22)25-18-23-17-24(37-4-2)15-16-26(23)30-29(25)36/h5-18,27H,3-4,19-20H2,1-2H3,(H,30,36)/t27-/m1/s1 |
| InChIKey | UXGFOVSQOPWHBO-HHHXNRCGSA-N |
| XLogP | 4.57 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |