About pyren-1-ylmethanamine;hydrochloride
pyren-1-ylmethanamine;hydrochloride (PubChem CID 11601427) has the molecular formula C17H14ClN
and a molecular weight of 267.76 g/mol. Its IUPAC name is pyren-1-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | pyren-1-ylmethanamine;hydrochloride |
| PubChem CID | 11601427 |
| Molecular Formula | C17H14ClN |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | pyren-1-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H13N.ClH/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12;/h1-9H,10,18H2;1H |
| InChIKey | RGNMXKKNDSHTFD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-ylmethanamine;hydrochloride?
The IUPAC name of pyren-1-ylmethanamine;hydrochloride (CID 11601427) is pyren-1-ylmethanamine;hydrochloride.
What is the SMILES notation for pyren-1-ylmethanamine;hydrochloride?
The canonical SMILES for pyren-1-ylmethanamine;hydrochloride is Cl.NCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyren-1-ylmethanamine;hydrochloride?
The InChIKey is RGNMXKKNDSHTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N.ClH/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12;/h1-9H,10,18H2;1H.
What are the key properties of pyren-1-ylmethanamine;hydrochloride?
pyren-1-ylmethanamine;hydrochloride has a molecular weight of 267.76 g/mol, XLogP of 4.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-ylmethanamine;hydrochloride is sourced from PubChem (CID 11601427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).