C13H22O4S — CID 11601514
(3S,4R,6S,7R)-4,6-dimethyl-1,1-dioxo-3-propyl-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 11601514) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is (3S,4R,6S,7R)-4,6-dimethyl-1,1-dioxo-3-propyl-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (3S,4R,6S,7R)-4,6-dimethyl-1,1-dioxo-3-propyl-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 11601514 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (3S,4R,6S,7R)-4,6-dimethyl-1,1-dioxo-3-propyl-3,4,6,7,8,8a-hexahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | CCC[C@@H]1OS(=O)(=O)C2C[C@@H](O)[C@@H](C)C=C2[C@H]1C |
| InChI | InChI=1S/C13H22O4S/c1-4-5-12-9(3)10-6-8(2)11(14)7-13(10)18(15,16)17-12/h6,8-9,11-14H,4-5,7H2,1-3H3/t8-,9+,11+,12-,13?/m0/s1 |
| InChIKey | BCLUQZNGGQJMKV-NQQOIHORSA-N |
| XLogP | 1.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|