C14H16O6 — CID 11601572
(3E,6R,9E,14R)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8,11-tetrone (PubChem CID 11601572) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3E,6R,9E,14R)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8,11-tetrone.
| Compound Name | (3E,6R,9E,14R)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 11601572 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3E,6R,9E,14R)-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8,11-tetrone |
| SMILES | C[C@@H]1CCC(=O)/C=C/C(=O)O[C@H](C)C(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C14H16O6/c1-9-3-4-11(15)5-7-14(18)20-10(2)12(16)6-8-13(17)19-9/h5-10H,3-4H2,1-2H3/b7-5+,8-6+/t9-,10-/m1/s1 |
| InChIKey | UFCYWVGYMRDUMX-PKVXPVJZSA-N |
| XLogP | 0.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |