About N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine
N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine (PubChem CID 11601694) has the molecular formula C16H12N6
and a molecular weight of 288.31 g/mol. Its IUPAC name is N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine |
| PubChem CID | 11601694 |
| Molecular Formula | C16H12N6 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine |
| SMILES | c1ccc(Nc2ncc3nnn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C16H12N6/c1-3-7-12(8-4-1)18-16-17-11-14-15(19-16)22(21-20-14)13-9-5-2-6-10-13/h1-11H,(H,17,18,19) |
| InChIKey | QVWXPISCAWQJJE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine?
The IUPAC name of N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine (CID 11601694) is N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine.
What is the SMILES notation for N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine?
The canonical SMILES for N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine is c1ccc(Nc2ncc3nnn(-c4ccccc4)c3n2)cc1.
What is the InChIKey of N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine?
The InChIKey is QVWXPISCAWQJJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6/c1-3-7-12(8-4-1)18-16-17-11-14-15(19-16)22(21-20-14)13-9-5-2-6-10-13/h1-11H,(H,17,18,19).
What are the key properties of N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine?
N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine has a molecular weight of 288.31 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-diphenyltriazolo[4,5-d]pyrimidin-5-amine is sourced from PubChem (CID 11601694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).