About 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate
6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate (PubChem CID 11602125) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate.
Molecular Properties
| Compound Name | 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate |
| PubChem CID | 11602125 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate |
| SMILES | O=C(OCCCCCCn1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O4/c20-15-10-12-19(17(22)18-15)11-6-1-2-7-13-23-16(21)14-8-4-3-5-9-14/h3-5,8-10,12H,1-2,6-7,11,13H2,(H,18,20,22) |
| InChIKey | DJKYWKNZGNOXPC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate?
The IUPAC name of 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate (CID 11602125) is 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate.
What is the SMILES notation for 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate?
The canonical SMILES for 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate is O=C(OCCCCCCn1ccc(=O)[nH]c1=O)c1ccccc1.
What is the InChIKey of 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate?
The InChIKey is DJKYWKNZGNOXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c20-15-10-12-19(17(22)18-15)11-6-1-2-7-13-23-16(21)14-8-4-3-5-9-14/h3-5,8-10,12H,1-2,6-7,11,13H2,(H,18,20,22).
What are the key properties of 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate?
6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate has a molecular weight of 316.36 g/mol, XLogP of 1.95, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dioxopyrimidin-1-yl)hexyl benzoate is sourced from PubChem (CID 11602125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).