About [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate
[(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate (PubChem CID 11602253) has the molecular formula C17H25O4P
and a molecular weight of 324.36 g/mol. Its IUPAC name is [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate.
Molecular Properties
| Compound Name | [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate |
| PubChem CID | 11602253 |
| Molecular Formula | C17H25O4P |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate |
| SMILES | C#C[C@@H](OP(=O)(OCC)OCC)C(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H25O4P/c1-6-16(21-22(18,19-7-2)20-8-3)17(4,5)14-15-12-10-9-11-13-15/h1,9-13,16H,7-8,14H2,2-5H3/t16-/m1/s1 |
| InChIKey | BMHBXKSVRSEEQX-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate?
The IUPAC name of [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate (CID 11602253) is [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate.
What is the SMILES notation for [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate?
The canonical SMILES for [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate is C#C[C@@H](OP(=O)(OCC)OCC)C(C)(C)Cc1ccccc1.
What is the InChIKey of [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate?
The InChIKey is BMHBXKSVRSEEQX-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H25O4P/c1-6-16(21-22(18,19-7-2)20-8-3)17(4,5)14-15-12-10-9-11-13-15/h1,9-13,16H,7-8,14H2,2-5H3/t16-/m1/s1.
What are the key properties of [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate?
[(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate has a molecular weight of 324.36 g/mol, XLogP of 4.45, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4,4-dimethyl-5-phenylpent-1-yn-3-yl] diethyl phosphate is sourced from PubChem (CID 11602253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).