C18H27NO5 — CID 11602485
ethyl (5Z,6S,7S,7aS)-7-(2,2-dimethylpropanoyloxy)-5-ethylidene-6-hydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate (PubChem CID 11602485) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (5Z,6S,7S,7aS)-7-(2,2-dimethylpropanoyloxy)-5-ethylidene-6-hydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate.
| Compound Name | ethyl (5Z,6S,7S,7aS)-7-(2,2-dimethylpropanoyloxy)-5-ethylidene-6-hydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11602485 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethyl (5Z,6S,7S,7aS)-7-(2,2-dimethylpropanoyloxy)-5-ethylidene-6-hydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
| SMILES | C/C=C1/C2=CCCN(C(=O)OCC)[C@@H]2[C@H](OC(=O)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C18H27NO5/c1-6-11-12-9-8-10-19(17(22)23-7-2)13(12)15(14(11)20)24-16(21)18(3,4)5/h6,9,13-15,20H,7-8,10H2,1-5H3/b11-6-/t13-,14-,15-/m0/s1 |
| InChIKey | IFQVERQKBIMBDM-FZKPQRPZSA-N |
| XLogP | 2.42 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |