C17H31BrOSi — CID 11602925
1-bromoethenyl-di(propan-2-yl)-(3,5,5-trimethylcyclohex-2-en-1-yl)oxysilane (PubChem CID 11602925) has the molecular formula C17H31BrOSi and a molecular weight of 359.42 g/mol. Its IUPAC name is 1-bromoethenyl-di(propan-2-yl)-(3,5,5-trimethylcyclohex-2-en-1-yl)oxysilane.
| Compound Name | 1-bromoethenyl-di(propan-2-yl)-(3,5,5-trimethylcyclohex-2-en-1-yl)oxysilane |
|---|---|
| PubChem CID | 11602925 |
| Molecular Formula | C17H31BrOSi |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-bromoethenyl-di(propan-2-yl)-(3,5,5-trimethylcyclohex-2-en-1-yl)oxysilane |
| SMILES | C=C(Br)[Si](OC1C=C(C)CC(C)(C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H31BrOSi/c1-12(2)20(13(3)4,15(6)18)19-16-9-14(5)10-17(7,8)11-16/h9,12-13,16H,6,10-11H2,1-5,7-8H3 |
| InChIKey | GELVSCLBALNESR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|