C22H30N4O — CID 11603069
6-(6-methyl-3-pyridinyl)-2-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 11603069) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 6-(6-methyl-3-pyridinyl)-2-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-(6-methyl-3-pyridinyl)-2-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 11603069 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 6-(6-methyl-3-pyridinyl)-2-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | Cc1ccc(N2CCc3nc(OCCCN4CCC[C@H]4C)ccc3C2)cn1 |
| InChI | InChI=1S/C22H30N4O/c1-17-6-8-20(15-23-17)26-13-10-21-19(16-26)7-9-22(24-21)27-14-4-12-25-11-3-5-18(25)2/h6-9,15,18H,3-5,10-14,16H2,1-2H3/t18-/m1/s1 |
| InChIKey | YIKHUEQGKFLXNZ-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|