C24H22N2O2 — CID 11603130
N-[[(2S)-oxolan-2-yl]methyl]-2,3-diphenylfuro[2,3-b]pyridin-4-amine (PubChem CID 11603130) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-2,3-diphenylfuro[2,3-b]pyridin-4-amine.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-2,3-diphenylfuro[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 11603130 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-2,3-diphenylfuro[2,3-b]pyridin-4-amine |
| SMILES | c1ccc(-c2oc3nccc(NC[C@@H]4CCCO4)c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-3-8-17(9-4-1)21-22-20(26-16-19-12-7-15-27-19)13-14-25-24(22)28-23(21)18-10-5-2-6-11-18/h1-6,8-11,13-14,19H,7,12,15-16H2,(H,25,26)/t19-/m0/s1 |
| InChIKey | BDRDZIHCMNAENW-IBGZPJMESA-N |
| XLogP | 5.75 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |