C17H13F6NO3 — CID 11603558
N-[3,5-bis(trifluoromethyl)phenyl]-2,4-dioxobicyclo[3.2.1]octane-3-carboxamide (PubChem CID 11603558) has the molecular formula C17H13F6NO3 and a molecular weight of 393.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2,4-dioxobicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,4-dioxobicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 11603558 |
| Molecular Formula | C17H13F6NO3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2,4-dioxobicyclo[3.2.1]octane-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C17H13F6NO3/c18-16(19,20)9-4-10(17(21,22)23)6-11(5-9)24-15(27)12-13(25)7-1-2-8(3-7)14(12)26/h4-8,12H,1-3H2,(H,24,27) |
| InChIKey | MBEBOYONPAUMCI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|