C21H30O7 — CID 11603581
5-[[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl]oxy]-5-oxopentanoic acid (PubChem CID 11603581) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is 5-[[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl]oxy]-5-oxopentanoic acid.
| Compound Name | 5-[[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl]oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11603581 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 5-[[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl]oxy]-5-oxopentanoic acid |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](OC(=O)CCCC(=O)O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C21H30O7/c1-14-6-3-2-4-7-15-12-16(22)13-17(15)18(10-11-21(26)27-14)28-20(25)9-5-8-19(23)24/h4,7,10-11,14-18,22H,2-3,5-6,8-9,12-13H2,1H3,(H,23,24)/b7-4+,11-10+/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | MOGVXKCDKQZYPO-KPAKZFSHSA-N |
| XLogP | 2.77 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|