C18H29N7O4 — CID 11603882
N-hydroxy-N-[[(5R)-15-morpholin-4-yl-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]formamide (PubChem CID 11603882) has the molecular formula C18H29N7O4 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-hydroxy-N-[[(5R)-15-morpholin-4-yl-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]formamide.
| Compound Name | N-hydroxy-N-[[(5R)-15-morpholin-4-yl-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 11603882 |
| Molecular Formula | C18H29N7O4 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-hydroxy-N-[[(5R)-15-morpholin-4-yl-4-oxo-2,3,14,16,17-pentazabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-yl]methyl]formamide |
| SMILES | O=CN(O)C[C@H]1CCCCCCCc2nc(nc(N3CCOCC3)n2)NNC1=O |
| InChI | InChI=1S/C18H29N7O4/c26-13-25(28)12-14-6-4-2-1-3-5-7-15-19-17(23-22-16(14)27)21-18(20-15)24-8-10-29-11-9-24/h13-14,28H,1-12H2,(H,22,27)(H,19,20,21,23)/t14-/m1/s1 |
| InChIKey | SXHMLSUYLCTWGV-CQSZACIVSA-N |
| XLogP | 0.51 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|