C24H26ClN3O2 — CID 11604236
2-(3-chlorophenoxy)-N-[1-[(3-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]acetamide (PubChem CID 11604236) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[1-[(3-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[1-[(3-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11604236 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[1-[(3-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NC1CCN(Cc2cccc(-n3cccc3)c2)CC1 |
| InChI | InChI=1S/C24H26ClN3O2/c25-20-6-4-8-23(16-20)30-18-24(29)26-21-9-13-27(14-10-21)17-19-5-3-7-22(15-19)28-11-1-2-12-28/h1-8,11-12,15-16,21H,9-10,13-14,17-18H2,(H,26,29) |
| InChIKey | FBHJAUBQAWIZFE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |