C19H11F3N6OS — CID 11604338
4-(pyrimidin-4-ylamino)-N-[3-(3,4,5-trifluorophenyl)-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 11604338) has the molecular formula C19H11F3N6OS and a molecular weight of 428.40 g/mol. Its IUPAC name is 4-(pyrimidin-4-ylamino)-N-[3-(3,4,5-trifluorophenyl)-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 4-(pyrimidin-4-ylamino)-N-[3-(3,4,5-trifluorophenyl)-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 11604338 |
| Molecular Formula | C19H11F3N6OS |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4-(pyrimidin-4-ylamino)-N-[3-(3,4,5-trifluorophenyl)-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2cc(F)c(F)c(F)c2)ns1)c1ccc(Nc2ccncn2)cc1 |
| InChI | InChI=1S/C19H11F3N6OS/c20-13-7-11(8-14(21)16(13)22)17-26-19(30-28-17)27-18(29)10-1-3-12(4-2-10)25-15-5-6-23-9-24-15/h1-9H,(H,23,24,25)(H,26,27,28,29) |
| InChIKey | RYYKQSRDVFDOJE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|