C21H20FN3O4S — CID 11604373
3-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-6-fluoro-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione (PubChem CID 11604373) has the molecular formula C21H20FN3O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is 3-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-6-fluoro-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione.
| Compound Name | 3-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-6-fluoro-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 11604373 |
| Molecular Formula | C21H20FN3O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-6-fluoro-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)C(C2=CS(=O)(=O)c3ccccc3N2)C(=O)c2cc(F)cnc21 |
| InChI | InChI=1S/C21H20FN3O4S/c1-12(2)7-8-25-20-14(9-13(22)10-23-20)19(26)18(21(25)27)16-11-30(28,29)17-6-4-3-5-15(17)24-16/h3-6,9-12,18,24H,7-8H2,1-2H3 |
| InChIKey | YTTPOZZZVUHZSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|