C20H18ClF6NO — CID 11604554
4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(3-chlorophenyl)piperidine (PubChem CID 11604554) has the molecular formula C20H18ClF6NO and a molecular weight of 437.81 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(3-chlorophenyl)piperidine.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(3-chlorophenyl)piperidine |
|---|---|
| PubChem CID | 11604554 |
| Molecular Formula | C20H18ClF6NO |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(3-chlorophenyl)piperidine |
| SMILES | FC(F)(F)c1cc(COC2CCNCC2c2cccc(Cl)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18ClF6NO/c21-16-3-1-2-13(8-16)17-10-28-5-4-18(17)29-11-12-6-14(19(22,23)24)9-15(7-12)20(25,26)27/h1-3,6-9,17-18,28H,4-5,10-11H2 |
| InChIKey | UXOUUJLIROXYGO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |