C19H23BrO7 — CID 11604669
(4S,9R)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-2,3,4,9-tetrahydroxanthen-1-one (PubChem CID 11604669) has the molecular formula C19H23BrO7 and a molecular weight of 443.29 g/mol. Its IUPAC name is (4S,9R)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-2,3,4,9-tetrahydroxanthen-1-one.
| Compound Name | (4S,9R)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-2,3,4,9-tetrahydroxanthen-1-one |
|---|---|
| PubChem CID | 11604669 |
| Molecular Formula | C19H23BrO7 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (4S,9R)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-2,3,4,9-tetrahydroxanthen-1-one |
| SMILES | COCCOCO[C@H]1CCC(=O)C2=C1Oc1cc(C)c(Br)c(OC)c1[C@H]2O |
| InChI | InChI=1S/C19H23BrO7/c1-10-8-13-15(19(24-3)16(10)20)17(22)14-11(21)4-5-12(18(14)27-13)26-9-25-7-6-23-2/h8,12,17,22H,4-7,9H2,1-3H3/t12-,17-/m0/s1 |
| InChIKey | TWTQXZSNHYOVHA-SJCJKPOMSA-N |
| XLogP | 2.81 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|