C24H37NO5Si — CID 11604778
tert-butyl 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]benzoate (PubChem CID 11604778) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]benzoate.
| Compound Name | tert-butyl 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]benzoate |
|---|---|
| PubChem CID | 11604778 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | tert-butyl 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]benzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1CC(=O)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H37NO5Si/c1-15(30-31(8,9)24(5,6)7)20-18(25-21(20)27)14-19(26)16-10-12-17(13-11-16)22(28)29-23(2,3)4/h10-13,15,18,20H,14H2,1-9H3,(H,25,27)/t15-,18-,20-/m1/s1 |
| InChIKey | MSICLGNSVVCYIF-XFQXTVEOSA-N |
| XLogP | 4.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|