C26H19Cl2N3O — CID 11604992
4-(3-chlorophenyl)-6-[(4-chlorophenyl)-imidazol-1-ylmethyl]-1-methylquinolin-2-one (PubChem CID 11604992) has the molecular formula C26H19Cl2N3O and a molecular weight of 460.36 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-6-[(4-chlorophenyl)-imidazol-1-ylmethyl]-1-methylquinolin-2-one.
| Compound Name | 4-(3-chlorophenyl)-6-[(4-chlorophenyl)-imidazol-1-ylmethyl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 11604992 |
| Molecular Formula | C26H19Cl2N3O |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-(3-chlorophenyl)-6-[(4-chlorophenyl)-imidazol-1-ylmethyl]-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)cc(-c2cccc(Cl)c2)c2cc(C(c3ccc(Cl)cc3)n3ccnc3)ccc21 |
| InChI | InChI=1S/C26H19Cl2N3O/c1-30-24-10-7-19(26(31-12-11-29-16-31)17-5-8-20(27)9-6-17)14-23(24)22(15-25(30)32)18-3-2-4-21(28)13-18/h2-16,26H,1H3 |
| InChIKey | LNMVKTAEIBQKGC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |