C18H23NO11S — CID 11605015
(2S,3S,4S,5R)-6-[[2-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]sulfanyl-1H-indol-3-yl]oxy]oxane-2,3,4,5-tetrol (PubChem CID 11605015) has the molecular formula C18H23NO11S and a molecular weight of 461.45 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[[2-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]sulfanyl-1H-indol-3-yl]oxy]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5R)-6-[[2-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]sulfanyl-1H-indol-3-yl]oxy]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11605015 |
| Molecular Formula | C18H23NO11S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (2S,3S,4S,5R)-6-[[2-[(3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]sulfanyl-1H-indol-3-yl]oxy]oxane-2,3,4,5-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)C(Oc2c(SC3O[C@H](O)[C@@H](O)[C@H](O)[C@H]3O)[nH]c3ccccc23)O[C@@H]1O |
| InChI | InChI=1S/C18H23NO11S/c20-7-9(22)15(26)29-17(11(7)24)28-13-5-3-1-2-4-6(5)19-14(13)31-18-12(25)8(21)10(23)16(27)30-18/h1-4,7-12,15-27H/t7-,8-,9-,10-,11+,12+,15-,16-,17?,18?/m0/s1 |
| InChIKey | YJRJBQQRZSSAAK-XCSQNAGMSA-N |
| XLogP | -2.85 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |