C20H26F3N9O — CID 11605112
5-(1,4-diazepan-1-yl)-3-ethyl-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 11605112) has the molecular formula C20H26F3N9O and a molecular weight of 465.48 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-3-ethyl-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(1,4-diazepan-1-yl)-3-ethyl-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11605112 |
| Molecular Formula | C20H26F3N9O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-3-ethyl-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCc1nn(CCOCC(F)(F)F)c2c(Nc3ccncn3)nc(N3CCCNCC3)nc12 |
| InChI | InChI=1S/C20H26F3N9O/c1-2-14-16-17(32(30-14)10-11-33-12-20(21,22)23)18(27-15-4-6-25-13-26-15)29-19(28-16)31-8-3-5-24-7-9-31/h4,6,13,24H,2-3,5,7-12H2,1H3,(H,25,26,27,28,29) |
| InChIKey | KBQCZXKHJACKAD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|