C27H28ClNO4 — CID 11605124
(1R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-[2-(dimethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 11605124) has the molecular formula C27H28ClNO4 and a molecular weight of 465.98 g/mol. Its IUPAC name is (1R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-[2-(dimethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-[2-(dimethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 11605124 |
| Molecular Formula | C27H28ClNO4 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (1R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-[2-(dimethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | CN(C)CCOc1ccc2c(c1)O[C@@]1(c3ccc(Cl)cc3)[C@H](c3ccccc3)C[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C27H28ClNO4/c1-29(2)14-15-32-21-12-13-22-24(16-21)33-27(19-8-10-20(28)11-9-19)23(17-25(30)26(22,27)31)18-6-4-3-5-7-18/h3-13,16,23,25,30-31H,14-15,17H2,1-2H3/t23-,25+,26-,27-/m0/s1 |
| InChIKey | QFHFNAOBEMZKPK-KMQNXVAFSA-N |
| XLogP | 4.30 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |