C24H25F2N3O3S — CID 11605283
4-(2,4-difluorophenyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 11605283) has the molecular formula C24H25F2N3O3S and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 11605283 |
| Molecular Formula | C24H25F2N3O3S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-(3-ethoxypropyl)-10-methyl-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | CCOCCCNC(=O)C1c2c(n(C)c3ccccc23)SCC(=O)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C24H25F2N3O3S/c1-3-32-12-6-11-27-23(31)22-21-16-7-4-5-8-18(16)28(2)24(21)33-14-20(30)29(22)19-10-9-15(25)13-17(19)26/h4-5,7-10,13,22H,3,6,11-12,14H2,1-2H3,(H,27,31) |
| InChIKey | VTCFSTDPXOWTNP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|